C20H33BrO3Si — CID 135046052
(5Z)-5-[(4R,5R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ylidene]pent-3-yn-2-ol (PubChem CID 135046052) has the molecular formula C20H33BrO3Si and a molecular weight of 429.47 g/mol. Its IUPAC name is (5Z)-5-[(4R,5R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ylidene]pent-3-yn-2-ol.
| Compound Name | (5Z)-5-[(4R,5R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ylidene]pent-3-yn-2-ol |
|---|---|
| PubChem CID | 135046052 |
| Molecular Formula | C20H33BrO3Si |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (5Z)-5-[(4R,5R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ylidene]pent-3-yn-2-ol |
| SMILES | CC(O)C#C/C=C1\C(Br)=C[C@@H](OC(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33BrO3Si/c1-14(22)11-10-12-15-16(21)13-17(23-19(2,3)4)18(15)24-25(8,9)20(5,6)7/h12-14,17-18,22H,1-9H3/b15-12+/t14?,17-,18-/m1/s1 |
| InChIKey | KSNJVIJOHHLJNV-JXTLLDGUSA-N |
| XLogP | 5.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|