C16H27BrO2 — CID 135046075
2-[(1E,3S,5Z)-1-bromoundeca-1,5-dien-3-yl]oxyoxane (PubChem CID 135046075) has the molecular formula C16H27BrO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-[(1E,3S,5Z)-1-bromoundeca-1,5-dien-3-yl]oxyoxane.
| Compound Name | 2-[(1E,3S,5Z)-1-bromoundeca-1,5-dien-3-yl]oxyoxane |
|---|---|
| PubChem CID | 135046075 |
| Molecular Formula | C16H27BrO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-[(1E,3S,5Z)-1-bromoundeca-1,5-dien-3-yl]oxyoxane |
| SMILES | CCCCC/C=C\C[C@@H](/C=C/Br)OC1CCCCO1 |
| InChI | InChI=1S/C16H27BrO2/c1-2-3-4-5-6-7-10-15(12-13-17)19-16-11-8-9-14-18-16/h6-7,12-13,15-16H,2-5,8-11,14H2,1H3/b7-6-,13-12+/t15-,16?/m0/s1 |
| InChIKey | UWDDVZDBJIKWJR-GXRZVBRCSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|