About diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate
diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate (PubChem CID 135046118) has the molecular formula C18H34O7Si
and a molecular weight of 390.55 g/mol. Its IUPAC name is diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate.
Molecular Properties
| Compound Name | diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate |
| PubChem CID | 135046118 |
| Molecular Formula | C18H34O7Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate |
| SMILES | CCOC(=O)CC(CC(C)(C)C(OC(C)=O)O[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H34O7Si/c1-9-22-15(20)11-14(16(21)23-10-2)12-18(4,5)17(24-13(3)19)25-26(6,7)8/h14,17H,9-12H2,1-8H3 |
| InChIKey | YTMONVUSMVWQHV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate?
The IUPAC name of diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate (CID 135046118) is diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate.
What is the SMILES notation for diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate?
The canonical SMILES for diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate is CCOC(=O)CC(CC(C)(C)C(OC(C)=O)O[Si](C)(C)C)C(=O)OCC.
What is the InChIKey of diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate?
The InChIKey is YTMONVUSMVWQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O7Si/c1-9-22-15(20)11-14(16(21)23-10-2)12-18(4,5)17(24-13(3)19)25-26(6,7)8/h14,17H,9-12H2,1-8H3.
What are the key properties of diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate?
diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate has a molecular weight of 390.55 g/mol, XLogP of 3.28, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(3-acetyloxy-2,2-dimethyl-3-trimethylsilyloxypropyl)butanedioate is sourced from PubChem (CID 135046118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).