C22H34HgO4 — CID 135046131
bis[[(1R,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-carbonyl]oxy]mercury (PubChem CID 135046131) has the molecular formula C22H34HgO4 and a molecular weight of 563.10 g/mol. Its IUPAC name is bis[[(1R,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-carbonyl]oxy]mercury.
| Compound Name | bis[[(1R,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-carbonyl]oxy]mercury |
|---|---|
| PubChem CID | 135046131 |
| Molecular Formula | C22H34HgO4 |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | bis[[(1R,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-carbonyl]oxy]mercury |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](C(=O)O[Hg]OC(=O)[C@@H]1C[C@@H]3CC[C@@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/2C11H18O2.Hg/c2*1-10(2)7-4-5-11(10,3)8(6-7)9(12)13;/h2*7-8H,4-6H2,1-3H3,(H,12,13);/q;;+2/p-2/t2*7-,8-,11+;/m00./s1 |
| InChIKey | HAQJXOYRFQORJX-OXDLFHAGSA-L |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|