C35H46O5Si — CID 135046145
[(2S,4S,5R,7R,8S)-8-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-5-methyl-12-oxo-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-yl] acetate (PubChem CID 135046145) has the molecular formula C35H46O5Si and a molecular weight of 574.83 g/mol. Its IUPAC name is [(2S,4S,5R,7R,8S)-8-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-5-methyl-12-oxo-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-yl] acetate.
| Compound Name | [(2S,4S,5R,7R,8S)-8-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-5-methyl-12-oxo-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-yl] acetate |
|---|---|
| PubChem CID | 135046145 |
| Molecular Formula | C35H46O5Si |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | [(2S,4S,5R,7R,8S)-8-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-5-methyl-12-oxo-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)[C@@H]2C[C@@H]2C2=C(COC2=O)[C@@H]1[C@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H46O5Si/c1-23(32-30-22-38-34(37)33(30)29-21-28(29)24(2)20-31(32)40-25(3)36)14-13-19-39-41(35(4,5)6,26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-12,15-18,23-24,28-29,31-32H,13-14,19-22H2,1-6H3/t23-,24-,28+,29+,31-,32+/m1/s1 |
| InChIKey | HPRFALXXGFVSGU-YKQCIYCXSA-N |
| XLogP | 6.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|