C14Br8F2HgO4 — CID 135046339
bis[(2,3,5,6-tetrabromo-4-fluorobenzoyl)oxy]mercury (PubChem CID 135046339) has the molecular formula C14Br8F2HgO4 and a molecular weight of 1109.97 g/mol. Its IUPAC name is bis[(2,3,5,6-tetrabromo-4-fluorobenzoyl)oxy]mercury.
| Compound Name | bis[(2,3,5,6-tetrabromo-4-fluorobenzoyl)oxy]mercury |
|---|---|
| PubChem CID | 135046339 |
| Molecular Formula | C14Br8F2HgO4 |
| Molecular Weight | 1109.97 g/mol |
| Exact Mass | 1103.29 |
| IUPAC Name | bis[(2,3,5,6-tetrabromo-4-fluorobenzoyl)oxy]mercury |
| SMILES | O=C(O[Hg]OC(=O)c1c(Br)c(Br)c(F)c(Br)c1Br)c1c(Br)c(Br)c(F)c(Br)c1Br |
| InChI | InChI=1S/2C7HBr4FO2.Hg/c2*8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;/h2*(H,13,14);/q;;+2/p-2 |
| InChIKey | XVOCEZCZCMMFIB-UHFFFAOYSA-L |
| XLogP | 8.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1109.97 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|