About 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium
2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium (PubChem CID 135046393) has the molecular formula C22H48NO5Ti-
and a molecular weight of 454.50 g/mol. Its IUPAC name is 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium.
Molecular Properties
| Compound Name | 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium |
| PubChem CID | 135046393 |
| Molecular Formula | C22H48NO5Ti- |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium |
| SMILES | CC(C)=C(C)[CH-]OC(=O)N(C(C)C)C(C)C.CC(C)O.CC(C)O.CC(C)O.[Ti] |
| InChI | InChI=1S/C13H24NO2.3C3H8O.Ti/c1-9(2)12(7)8-16-13(15)14(10(3)4)11(5)6;3*1-3(2)4;/h8,10-11H,1-7H3;3*3-4H,1-2H3;/q-1;;;; |
| InChIKey | SEAXBNWNEBRPBE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium?
The IUPAC name of 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium (CID 135046393) is 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium.
What is the SMILES notation for 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium?
The canonical SMILES for 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium is CC(C)=C(C)[CH-]OC(=O)N(C(C)C)C(C)C.CC(C)O.CC(C)O.CC(C)O.[Ti].
What is the InChIKey of 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium?
The InChIKey is SEAXBNWNEBRPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24NO2.3C3H8O.Ti/c1-9(2)12(7)8-16-13(15)14(10(3)4)11(5)6;3*1-3(2)4;/h8,10-11H,1-7H3;3*3-4H,1-2H3;/q-1;;;;.
What are the key properties of 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium?
2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium has a molecular weight of 454.50 g/mol, XLogP of 4.92, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbut-2-enyl N,N-di(propan-2-yl)carbamate;tris(propan-2-ol);titanium is sourced from PubChem (CID 135046393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).