About CID 135046786
CID 135046786 (PubChem CID 135046786) has the molecular formula C51H71O2Si5Y-
and a molecular weight of 945.46 g/mol.
Molecular Properties
| Compound Name | CID 135046786 |
| PubChem CID | 135046786 |
| Molecular Formula | C51H71O2Si5Y- |
| Molecular Weight | 945.46 g/mol |
| Exact Mass | 944.34 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[C]1[CH][C]([Si](C)(C)C)[C]([Si]2([C]3[CH][C](C(C)(C)C)[CH][C]3[Si](C)(C)C)Oc3ccc4ccccc4c3-c3c(ccc4ccccc34)O2)[CH]1.C[Si](C)(C)[CH-][Si](C)(C)C.[Y] |
| InChI | InChI=1S/C44H52O2Si3.C7H19Si2.Y/c1-43(2,3)31-25-37(47(7,8)9)39(27-31)49(40-28-32(44(4,5)6)26-38(40)48(10,11)12)45-35-23-21-29-17-13-15-19-33(29)41(35)42-34-20-16-14-18-30(34)22-24-36(42)46-49;1-8(2,3)7-9(4,5)6;/h13-28H,1-12H3;7H,1-6H3;/q;-1; |
| InChIKey | DLRMXGHVCYSVSJ-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 945.46 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135046786 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135046786?
The IUPAC name of CID 135046786 (CID 135046786) is not available.
What is the SMILES notation for CID 135046786?
The canonical SMILES for CID 135046786 is CC(C)(C)[C]1[CH][C]([Si](C)(C)C)[C]([Si]2([C]3[CH][C](C(C)(C)C)[CH][C]3[Si](C)(C)C)Oc3ccc4ccccc4c3-c3c(ccc4ccccc34)O2)[CH]1.C[Si](C)(C)[CH-][Si](C)(C)C.[Y].
What is the InChIKey of CID 135046786?
The InChIKey is DLRMXGHVCYSVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H52O2Si3.C7H19Si2.Y/c1-43(2,3)31-25-37(47(7,8)9)39(27-31)49(40-28-32(44(4,5)6)26-38(40)48(10,11)12)45-35-23-21-29-17-13-15-19-33(29)41(35)42-34-20-16-14-18-30(34)22-24-36(42)46-49;1-8(2,3)7-9(4,5)6;/h13-28H,1-12H3;7H,1-6H3;/q;-1;.
What are the key properties of CID 135046786?
CID 135046786 has a molecular weight of 945.46 g/mol, XLogP of 15.03, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135046786 is sourced from PubChem (CID 135046786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).