About CID 135046913
CID 135046913 (PubChem CID 135046913) has the molecular formula C14H29Cl2Si3Ti
and a molecular weight of 400.42 g/mol.
Molecular Properties
| Compound Name | CID 135046913 |
| PubChem CID | 135046913 |
| Molecular Formula | C14H29Cl2Si3Ti |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)[CH]1.Cl[Ti]Cl |
| InChI | InChI=1S/C14H29Si3.2ClH.Ti/c1-15(2,3)12-10-13(16(4,5)6)14(11-12)17(7,8)9;;;/h10-11H,1-9H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ISTCXTWYQALZJY-UHFFFAOYSA-L |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135046913 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135046913?
The IUPAC name of CID 135046913 (CID 135046913) is not available.
What is the SMILES notation for CID 135046913?
The canonical SMILES for CID 135046913 is C[Si](C)(C)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)[CH]1.Cl[Ti]Cl.
What is the InChIKey of CID 135046913?
The InChIKey is ISTCXTWYQALZJY-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H29Si3.2ClH.Ti/c1-15(2,3)12-10-13(16(4,5)6)14(11-12)17(7,8)9;;;/h10-11H,1-9H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 135046913?
CID 135046913 has a molecular weight of 400.42 g/mol, XLogP of 6.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135046913 is sourced from PubChem (CID 135046913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).