About carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium
carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium (PubChem CID 135046948) has the molecular formula C17H13CrNO6
and a molecular weight of 379.29 g/mol. Its IUPAC name is carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium.
Molecular Properties
| Compound Name | carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium |
| PubChem CID | 135046948 |
| Molecular Formula | C17H13CrNO6 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])c1c(C)c2ccccc2n1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C12H13NO.5CO.Cr/c1-9-10-6-4-5-7-11(10)13(2)12(9)8-14-3;5*1-2;/h4-7H,1-3H3;;;;;; |
| InChIKey | ZFAAHJIFFXSKPO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium?
The IUPAC name of carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium (CID 135046948) is carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium.
What is the SMILES notation for carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium?
The canonical SMILES for carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium is COC(=[Cr])c1c(C)c2ccccc2n1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium?
The InChIKey is ZFAAHJIFFXSKPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.5CO.Cr/c1-9-10-6-4-5-7-11(10)13(2)12(9)8-14-3;5*1-2;/h4-7H,1-3H3;;;;;;.
What are the key properties of carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium?
carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium has a molecular weight of 379.29 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;[(1,3-dimethylindol-2-yl)-methoxymethylidene]chromium is sourced from PubChem (CID 135046948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).