C24H42O5Si — CID 135047282
[(2Z)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethyl] acetate (PubChem CID 135047282) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is [(2Z)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethyl] acetate.
| Compound Name | [(2Z)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 135047282 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [(2Z)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethyl] acetate |
| SMILES | CC(=O)OC/C=C1/C[C@H]2C[C@@H](OC3CCCCO3)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C24H42O5Si/c1-17(25)26-12-10-18-13-19-15-22(29-23-9-7-8-11-27-23)21(20(19)14-18)16-28-30(5,6)24(2,3)4/h10,19-23H,7-9,11-16H2,1-6H3/b18-10-/t19-,20-,21+,22+,23?/m0/s1 |
| InChIKey | SOCNZRFNZCDHTA-OHSAPURHSA-N |
| XLogP | 5.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|