About carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene
carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene (PubChem CID 135047753) has the molecular formula C17H16FeO4
and a molecular weight of 340.16 g/mol. Its IUPAC name is carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene |
| PubChem CID | 135047753 |
| Molecular Formula | C17H16FeO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene |
| SMILES | COC1=C[C@@H](c2ccccc2)CC=C1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C14H16O.3CO.Fe/c1-11-8-9-13(10-14(11)15-2)12-6-4-3-5-7-12;3*1-2;/h3-8,10,13H,9H2,1-2H3;;;;/t13-;;;;/m0..../s1 |
| InChIKey | JGEUSBWVHXRBPP-AHJYMZSGSA-N |
| XLogP | 3.54 |
| TPSA | 68.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene?
The IUPAC name of carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene (CID 135047753) is carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene.
What is the SMILES notation for carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene?
The canonical SMILES for carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene is COC1=C[C@@H](c2ccccc2)CC=C1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].
What is the InChIKey of carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene?
The InChIKey is JGEUSBWVHXRBPP-AHJYMZSGSA-N. The full InChI is InChI=1S/C14H16O.3CO.Fe/c1-11-8-9-13(10-14(11)15-2)12-6-4-3-5-7-12;3*1-2;/h3-8,10,13H,9H2,1-2H3;;;;/t13-;;;;/m0..../s1.
What are the key properties of carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene?
carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene has a molecular weight of 340.16 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;iron;(5S)-3-methoxy-2-methyl-5-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 135047753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).