C15H21O6- — CID 135047803
(E)-1,3-dimethoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]-3-oxoprop-1-en-1-olate (PubChem CID 135047803) has the molecular formula C15H21O6- and a molecular weight of 297.33 g/mol. Its IUPAC name is (E)-1,3-dimethoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]-3-oxoprop-1-en-1-olate.
| Compound Name | (E)-1,3-dimethoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 135047803 |
| Molecular Formula | C15H21O6- |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (E)-1,3-dimethoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]-3-oxoprop-1-en-1-olate |
| SMILES | COC(=O)/C(CC1=C(C)CC2(CC1)OCCO2)=C(\[O-])OC |
| InChI | InChI=1S/C15H22O6/c1-10-9-15(20-6-7-21-15)5-4-11(10)8-12(13(16)18-2)14(17)19-3/h16H,4-9H2,1-3H3/p-1/b13-12+ |
| InChIKey | JACHJRITTHRMFF-OUKQBFOZSA-M |
| XLogP | 1.01 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|