C23H32O5SSi — CID 135047827
[(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-[(1S)-4-methoxy-1-methylcyclohexa-2,4-dien-1-yl]-3-methyl-2-oxocyclopentyl] methanesulfonate (PubChem CID 135047827) has the molecular formula C23H32O5SSi and a molecular weight of 448.66 g/mol. Its IUPAC name is [(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-[(1S)-4-methoxy-1-methylcyclohexa-2,4-dien-1-yl]-3-methyl-2-oxocyclopentyl] methanesulfonate.
| Compound Name | [(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-[(1S)-4-methoxy-1-methylcyclohexa-2,4-dien-1-yl]-3-methyl-2-oxocyclopentyl] methanesulfonate |
|---|---|
| PubChem CID | 135047827 |
| Molecular Formula | C23H32O5SSi |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-[(1S)-4-methoxy-1-methylcyclohexa-2,4-dien-1-yl]-3-methyl-2-oxocyclopentyl] methanesulfonate |
| SMILES | COC1=CC[C@](C)([C@]2(C)C(=O)[C@@H](OS(C)(=O)=O)C[C@H]2[Si](C)(C)c2ccccc2)C=C1 |
| InChI | InChI=1S/C23H32O5SSi/c1-22(14-12-17(27-3)13-15-22)23(2)20(16-19(21(23)24)28-29(4,25)26)30(5,6)18-10-8-7-9-11-18/h7-14,19-20H,15-16H2,1-6H3/t19-,20+,22+,23-/m0/s1 |
| InChIKey | XWHLANJCVMXKOF-JVSAHFFESA-N |
| XLogP | 3.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|