About methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate
methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate (PubChem CID 135047868) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate.
Molecular Properties
| Compound Name | methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate |
| PubChem CID | 135047868 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate |
| SMILES | CCCCC(=O)C(C(=O)OC)[C@H]1C=C[C@@H](O)CC1 |
| InChI | InChI=1S/C14H22O4/c1-3-4-5-12(16)13(14(17)18-2)10-6-8-11(15)9-7-10/h6,8,10-11,13,15H,3-5,7,9H2,1-2H3/t10-,11+,13?/m0/s1 |
| InChIKey | QKJKGYOMRXCEBH-VUDPYIQVSA-N |
| XLogP | 1.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate?
The IUPAC name of methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate (CID 135047868) is methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate.
What is the SMILES notation for methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate?
The canonical SMILES for methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate is CCCCC(=O)C(C(=O)OC)[C@H]1C=C[C@@H](O)CC1.
What is the InChIKey of methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate?
The InChIKey is QKJKGYOMRXCEBH-VUDPYIQVSA-N. The full InChI is InChI=1S/C14H22O4/c1-3-4-5-12(16)13(14(17)18-2)10-6-8-11(15)9-7-10/h6,8,10-11,13,15H,3-5,7,9H2,1-2H3/t10-,11+,13?/m0/s1.
What are the key properties of methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate?
methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate has a molecular weight of 254.33 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,4S)-4-hydroxycyclohex-2-en-1-yl]-3-oxoheptanoate is sourced from PubChem (CID 135047868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).