About (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron
(4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron (PubChem CID 135047933) has the molecular formula C16H11FeNO4
and a molecular weight of 337.11 g/mol. Its IUPAC name is (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron.
Molecular Properties
| Compound Name | (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron |
| PubChem CID | 135047933 |
| Molecular Formula | C16H11FeNO4 |
| Molecular Weight | 337.11 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron |
| SMILES | CC1=CC2=N[C@H]3C=CC=C[C@H]3C2=CC1=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C13H11NO.3CO.Fe/c1-8-6-12-10(7-13(8)15)9-4-2-3-5-11(9)14-12;3*1-2;/h2-7,9,11H,1H3;;;;/t9-,11-;;;;/m0..../s1 |
| InChIKey | VIUFLWBUVMSKIH-WZWODHENSA-N |
| XLogP | 1.89 |
| TPSA | 89.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.11 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron?
The IUPAC name of (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron (CID 135047933) is (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron.
What is the SMILES notation for (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron?
The canonical SMILES for (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron is CC1=CC2=N[C@H]3C=CC=C[C@H]3C2=CC1=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].
What is the InChIKey of (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron?
The InChIKey is VIUFLWBUVMSKIH-WZWODHENSA-N. The full InChI is InChI=1S/C13H11NO.3CO.Fe/c1-8-6-12-10(7-13(8)15)9-4-2-3-5-11(9)14-12;3*1-2;/h2-7,9,11H,1H3;;;;/t9-,11-;;;;/m0..../s1.
What are the key properties of (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron?
(4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron has a molecular weight of 337.11 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron is sourced from PubChem (CID 135047933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).