C18H15FeNO4 — CID 135047961
(4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron (PubChem CID 135047961) has the molecular formula C18H15FeNO4 and a molecular weight of 365.17 g/mol. Its IUPAC name is (4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron.
| Compound Name | (4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron |
|---|---|
| PubChem CID | 135047961 |
| Molecular Formula | C18H15FeNO4 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | (4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron |
| SMILES | CC1=C(C)C2=N[C@H]3C=CC=C[C@H]3C2=C(C)C1=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C15H15NO.3CO.Fe/c1-8-9(2)15(17)10(3)13-11-6-4-5-7-12(11)16-14(8)13;3*1-2;/h4-7,11-12H,1-3H3;;;;/t11-,12+;;;;/m1..../s1 |
| InChIKey | GHOWULHYXBPGAQ-PWAPIHSDSA-N |
| XLogP | 2.67 |
| TPSA | 89.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|