C21H34O5Si — CID 135047977
dimethyl 2-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[(2E,4E)-hexa-2,4-dienyl]propanedioate (PubChem CID 135047977) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is dimethyl 2-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[(2E,4E)-hexa-2,4-dienyl]propanedioate.
| Compound Name | dimethyl 2-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[(2E,4E)-hexa-2,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 135047977 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | dimethyl 2-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[(2E,4E)-hexa-2,4-dienyl]propanedioate |
| SMILES | C/C=C/C=C/CC(CC#CCO[Si](C)(C)C(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H34O5Si/c1-9-10-11-12-15-21(18(22)24-5,19(23)25-6)16-13-14-17-26-27(7,8)20(2,3)4/h9-12H,15-17H2,1-8H3/b10-9+,12-11+ |
| InChIKey | RSUWFJBWDAAPKZ-HULFFUFUSA-N |
| XLogP | 4.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|