C16H17NO2 — CID 135047984
(4bS,8aR)-7-methoxy-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one (PubChem CID 135047984) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (4bS,8aR)-7-methoxy-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one.
| Compound Name | (4bS,8aR)-7-methoxy-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one |
|---|---|
| PubChem CID | 135047984 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (4bS,8aR)-7-methoxy-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one |
| SMILES | COC1=C[C@@H]2N=C3C(C)=C(C)C(=O)C(C)=C3[C@@H]2C=C1 |
| InChI | InChI=1S/C16H17NO2/c1-8-9(2)16(18)10(3)14-12-6-5-11(19-4)7-13(12)17-15(8)14/h5-7,12-13H,1-4H3/t12-,13+/m1/s1 |
| InChIKey | SHLKCPRHFYGQEW-OLZOCXBDSA-N |
| XLogP | 2.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|