About methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate
methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate (PubChem CID 135047987) has the molecular formula C15H26O3Si
and a molecular weight of 282.46 g/mol. Its IUPAC name is methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate.
Molecular Properties
| Compound Name | methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate |
| PubChem CID | 135047987 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate |
| SMILES | C=C(C)[C@H]1CC=C(C[Si](C)(C)C)[C@@H](OC(=O)OC)C1 |
| InChI | InChI=1S/C15H26O3Si/c1-11(2)12-7-8-13(10-19(4,5)6)14(9-12)18-15(16)17-3/h8,12,14H,1,7,9-10H2,2-6H3/t12-,14-/m0/s1 |
| InChIKey | KLLKYDCZDAVQBH-JSGCOSHPSA-N |
| XLogP | 4.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate?
The IUPAC name of methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate (CID 135047987) is methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate.
What is the SMILES notation for methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate?
The canonical SMILES for methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate is C=C(C)[C@H]1CC=C(C[Si](C)(C)C)[C@@H](OC(=O)OC)C1.
What is the InChIKey of methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate?
The InChIKey is KLLKYDCZDAVQBH-JSGCOSHPSA-N. The full InChI is InChI=1S/C15H26O3Si/c1-11(2)12-7-8-13(10-19(4,5)6)14(9-12)18-15(16)17-3/h8,12,14H,1,7,9-10H2,2-6H3/t12-,14-/m0/s1.
What are the key properties of methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate?
methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate has a molecular weight of 282.46 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(1S,5S)-5-prop-1-en-2-yl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl] carbonate is sourced from PubChem (CID 135047987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).