C13H27BO3Si — CID 135048099
tert-butyl-[(E)-3-[(4S,5S)-4,5-dimethyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 135048099) has the molecular formula C13H27BO3Si and a molecular weight of 270.25 g/mol. Its IUPAC name is tert-butyl-[(E)-3-[(4S,5S)-4,5-dimethyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-[(4S,5S)-4,5-dimethyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135048099 |
| Molecular Formula | C13H27BO3Si |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl-[(E)-3-[(4S,5S)-4,5-dimethyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | C[C@@H]1OB(/C=C/CO[Si](C)(C)C(C)(C)C)O[C@H]1C |
| InChI | InChI=1S/C13H27BO3Si/c1-11-12(2)17-14(16-11)9-8-10-15-18(6,7)13(3,4)5/h8-9,11-12H,10H2,1-7H3/b9-8+/t11-,12-/m0/s1 |
| InChIKey | XCIHXGOMHNFAAV-OMJLJAAMSA-N |
| XLogP | 3.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|