C23H45B — CID 135048195
[(1S,2R)-2-(2,6-dimethylhept-1-en-3-yl)-2-methylcyclopropyl]-bis(3-methylbutyl)borane (PubChem CID 135048195) has the molecular formula C23H45B and a molecular weight of 332.43 g/mol. Its IUPAC name is [(1S,2R)-2-(2,6-dimethylhept-1-en-3-yl)-2-methylcyclopropyl]-bis(3-methylbutyl)borane.
| Compound Name | [(1S,2R)-2-(2,6-dimethylhept-1-en-3-yl)-2-methylcyclopropyl]-bis(3-methylbutyl)borane |
|---|---|
| PubChem CID | 135048195 |
| Molecular Formula | C23H45B |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.36 |
| IUPAC Name | [(1S,2R)-2-(2,6-dimethylhept-1-en-3-yl)-2-methylcyclopropyl]-bis(3-methylbutyl)borane |
| SMILES | C=C(C)C(CCC(C)C)[C@]1(C)C[C@@H]1B(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C23H45B/c1-17(2)10-11-21(20(7)8)23(9)16-22(23)24(14-12-18(3)4)15-13-19(5)6/h17-19,21-22H,7,10-16H2,1-6,8-9H3/t21?,22-,23-/m0/s1 |
| InChIKey | JYZFCEHMYAEDQM-KXNJDZORSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|