C33H48O4S — CID 135048498
(2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5-methylhex-5-en-3-ol (PubChem CID 135048498) has the molecular formula C33H48O4S and a molecular weight of 540.81 g/mol. Its IUPAC name is (2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5-methylhex-5-en-3-ol.
| Compound Name | (2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 135048498 |
| Molecular Formula | C33H48O4S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | (2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5-methylhex-5-en-3-ol |
| SMILES | C=C(C)C([C@H](O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](OC)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H48O4S/c1-20(2)30(38(35,36)23-10-8-7-9-11-23)29(34)21(3)25-12-13-26-24-18-28(37-6)33-19-22(33)14-17-32(33,5)27(24)15-16-31(25,26)4/h7-11,21-22,24-30,34H,1,12-19H2,2-6H3/t21-,22+,24-,25+,26-,27-,28+,29+,30?,31+,32+,33-/m0/s1 |
| InChIKey | GGJKVMPGROFCRZ-VCIJGHAOSA-N |
| XLogP | 6.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|