About dichlorozinc;ethenyl(trimethyl)silane
dichlorozinc;ethenyl(trimethyl)silane (PubChem CID 135048516) has the molecular formula C5H11Cl2SiZn-
and a molecular weight of 235.52 g/mol. Its IUPAC name is dichlorozinc;ethenyl(trimethyl)silane.
Molecular Properties
| Compound Name | dichlorozinc;ethenyl(trimethyl)silane |
| PubChem CID | 135048516 |
| Molecular Formula | C5H11Cl2SiZn- |
| Molecular Weight | 235.52 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | dichlorozinc;ethenyl(trimethyl)silane |
| SMILES | C=[C-][Si](C)(C)C.Cl[Zn]Cl |
| InChI | InChI=1S/C5H11Si.2ClH.Zn/c1-5-6(2,3)4;;;/h1H2,2-4H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | FACHLFFUKWQGFN-UHFFFAOYSA-L |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;ethenyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;ethenyl(trimethyl)silane?
The IUPAC name of dichlorozinc;ethenyl(trimethyl)silane (CID 135048516) is dichlorozinc;ethenyl(trimethyl)silane.
What is the SMILES notation for dichlorozinc;ethenyl(trimethyl)silane?
The canonical SMILES for dichlorozinc;ethenyl(trimethyl)silane is C=[C-][Si](C)(C)C.Cl[Zn]Cl.
What is the InChIKey of dichlorozinc;ethenyl(trimethyl)silane?
The InChIKey is FACHLFFUKWQGFN-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H11Si.2ClH.Zn/c1-5-6(2,3)4;;;/h1H2,2-4H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozinc;ethenyl(trimethyl)silane?
dichlorozinc;ethenyl(trimethyl)silane has a molecular weight of 235.52 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;ethenyl(trimethyl)silane is sourced from PubChem (CID 135048516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).