About tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate
tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate (PubChem CID 135048527) has the molecular formula C21H30O4S
and a molecular weight of 378.53 g/mol. Its IUPAC name is tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate.
Molecular Properties
| Compound Name | tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate |
| PubChem CID | 135048527 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@@]1(S(=O)c2ccccc2)C=CC[C@@H]1O |
| InChI | InChI=1S/C21H30O4S/c1-20(2,3)25-19(23)14-8-5-9-15-21(16-10-13-18(21)22)26(24)17-11-6-4-7-12-17/h4,6-7,10-12,16,18,22H,5,8-9,13-15H2,1-3H3/t18-,21+,26?/m0/s1 |
| InChIKey | DXZHWMRASIELKR-ZSFYKYPJSA-N |
| XLogP | 4.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate?
The IUPAC name of tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate (CID 135048527) is tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate.
What is the SMILES notation for tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate?
The canonical SMILES for tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate is CC(C)(C)OC(=O)CCCCC[C@@]1(S(=O)c2ccccc2)C=CC[C@@H]1O.
What is the InChIKey of tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate?
The InChIKey is DXZHWMRASIELKR-ZSFYKYPJSA-N. The full InChI is InChI=1S/C21H30O4S/c1-20(2,3)25-19(23)14-8-5-9-15-21(16-10-13-18(21)22)26(24)17-11-6-4-7-12-17/h4,6-7,10-12,16,18,22H,5,8-9,13-15H2,1-3H3/t18-,21+,26?/m0/s1.
What are the key properties of tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate?
tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate has a molecular weight of 378.53 g/mol, XLogP of 4.15, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-[(1R,5S)-1-(benzenesulfinyl)-5-hydroxycyclopent-2-en-1-yl]hexanoate is sourced from PubChem (CID 135048527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).