C17H32O4 — CID 135048530
(2R,4S,5S,6R)-4-[(2R)-butan-2-yl]-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxane (PubChem CID 135048530) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2R,4S,5S,6R)-4-[(2R)-butan-2-yl]-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxane.
| Compound Name | (2R,4S,5S,6R)-4-[(2R)-butan-2-yl]-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 135048530 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (2R,4S,5S,6R)-4-[(2R)-butan-2-yl]-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxane |
| SMILES | CC[C@@H](C)[C@@H]1O[C@@H](C)O[C@@H]([C@]2(C)O[C@@H](C)O[C@@H]2CC)[C@H]1C |
| InChI | InChI=1S/C17H32O4/c1-8-10(3)15-11(4)16(20-12(5)19-15)17(7)14(9-2)18-13(6)21-17/h10-16H,8-9H2,1-7H3/t10-,11+,12-,13+,14-,15+,16-,17-/m1/s1 |
| InChIKey | UXDIDCKANWUVPK-VICCEGCOSA-N |
| XLogP | 3.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |