C17H30O5 — CID 135048531
[(2S)-2-[(4R,5S,6R)-6-acetyl-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate (PubChem CID 135048531) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is [(2S)-2-[(4R,5S,6R)-6-acetyl-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[(4R,5S,6R)-6-acetyl-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135048531 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [(2S)-2-[(4R,5S,6R)-6-acetyl-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)[C@@H]1OC(C)(C)O[C@H]([C@@H](C)COC(=O)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C17H30O5/c1-10(9-20-15(19)16(4,5)6)13-11(2)14(12(3)18)22-17(7,8)21-13/h10-11,13-14H,9H2,1-8H3/t10-,11-,13+,14+/m0/s1 |
| InChIKey | NFNGMAVYZPMPLE-CDGCEXEKSA-N |
| XLogP | 2.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |