C26H41N2O3P — CID 135048535
N-[[(4aR,4bS,10bR,12aR)-8-methoxy-4a,10b,12a-trimethyl-4,4b,5,6,11,12-hexahydro-3H-chrysen-1-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine (PubChem CID 135048535) has the molecular formula C26H41N2O3P and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[[(4aR,4bS,10bR,12aR)-8-methoxy-4a,10b,12a-trimethyl-4,4b,5,6,11,12-hexahydro-3H-chrysen-1-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine.
| Compound Name | N-[[(4aR,4bS,10bR,12aR)-8-methoxy-4a,10b,12a-trimethyl-4,4b,5,6,11,12-hexahydro-3H-chrysen-1-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 135048535 |
| Molecular Formula | C26H41N2O3P |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | N-[[(4aR,4bS,10bR,12aR)-8-methoxy-4a,10b,12a-trimethyl-4,4b,5,6,11,12-hexahydro-3H-chrysen-1-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@@]2(C)CC[C@@]2(C)C(OP(=O)(N(C)C)N(C)C)=CCC[C@]12C |
| InChI | InChI=1S/C26H41N2O3P/c1-24-16-17-26(3)23(31-32(29,27(4)5)28(6)7)10-9-15-25(26,2)22(24)14-11-19-18-20(30-8)12-13-21(19)24/h10,12-13,18,22H,9,11,14-17H2,1-8H3/t22-,24-,25+,26-/m0/s1 |
| InChIKey | PUGPPTRMZFFWKL-MNPUUQGPSA-N |
| XLogP | 6.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|