C18H35BO2Si — CID 135048786
tri(propan-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-ynyl]silane (PubChem CID 135048786) has the molecular formula C18H35BO2Si and a molecular weight of 322.37 g/mol. Its IUPAC name is tri(propan-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-ynyl]silane.
| Compound Name | tri(propan-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-ynyl]silane |
|---|---|
| PubChem CID | 135048786 |
| Molecular Formula | C18H35BO2Si |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | tri(propan-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-ynyl]silane |
| SMILES | CC(C)[Si](C#CCB1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H35BO2Si/c1-14(2)22(15(3)4,16(5)6)13-11-12-19-20-17(7,8)18(9,10)21-19/h14-16H,12H2,1-10H3 |
| InChIKey | FMIAIRMZSMWJMV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|