About cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine
cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine (PubChem CID 135048996) has the molecular formula C12H24BN
and a molecular weight of 193.14 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine |
| PubChem CID | 135048996 |
| Molecular Formula | C12H24BN |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 193.20 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine |
| SMILES | CCB(CC)C1=CC=CC1.CN(C)C |
| InChI | InChI=1S/C9H15B.C3H9N/c1-3-10(4-2)9-7-5-6-8-9;1-4(2)3/h5-7H,3-4,8H2,1-2H3;1-3H3 |
| InChIKey | ODZFTMHYWPFKHD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine?
The IUPAC name of cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine (CID 135048996) is cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine.
What is the SMILES notation for cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine?
The canonical SMILES for cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine is CCB(CC)C1=CC=CC1.CN(C)C.
What is the InChIKey of cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine?
The InChIKey is ODZFTMHYWPFKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15B.C3H9N/c1-3-10(4-2)9-7-5-6-8-9;1-4(2)3/h5-7H,3-4,8H2,1-2H3;1-3H3.
What are the key properties of cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine?
cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine has a molecular weight of 193.14 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yl(diethyl)borane;N,N-dimethylmethanamine is sourced from PubChem (CID 135048996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).