C21H32O3 — CID 135049013
[(1R,4E,8E,12S,13S)-4,8,12-trimethyl-15-oxo-13-bicyclo[10.2.2]hexadeca-4,8-dienyl] acetate (PubChem CID 135049013) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [(1R,4E,8E,12S,13S)-4,8,12-trimethyl-15-oxo-13-bicyclo[10.2.2]hexadeca-4,8-dienyl] acetate.
| Compound Name | [(1R,4E,8E,12S,13S)-4,8,12-trimethyl-15-oxo-13-bicyclo[10.2.2]hexadeca-4,8-dienyl] acetate |
|---|---|
| PubChem CID | 135049013 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(1R,4E,8E,12S,13S)-4,8,12-trimethyl-15-oxo-13-bicyclo[10.2.2]hexadeca-4,8-dienyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2CC/C(C)=C/CC/C(C)=C/CC[C@@]1(C)CC2=O |
| InChI | InChI=1S/C21H32O3/c1-15-7-5-8-16(2)10-11-18-13-20(24-17(3)22)21(4,12-6-9-15)14-19(18)23/h8-9,18,20H,5-7,10-14H2,1-4H3/b15-9+,16-8+/t18-,20+,21+/m1/s1 |
| InChIKey | NCTPCONYIYTWHO-JXYPWIJQSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|