C25H54OSiSn — CID 135049041
tert-butyl-dimethyl-[(E,2S)-7-tributylstannylhept-5-en-2-yl]oxysilane (PubChem CID 135049041) has the molecular formula C25H54OSiSn and a molecular weight of 517.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-7-tributylstannylhept-5-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-7-tributylstannylhept-5-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 135049041 |
| Molecular Formula | C25H54OSiSn |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-7-tributylstannylhept-5-en-2-yl]oxysilane |
| SMILES | CCCC[Sn](C/C=C/CC[C@H](C)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C13H27OSi.3C4H9.Sn/c1-8-9-10-11-12(2)14-15(6,7)13(3,4)5;3*1-3-4-2;/h8-9,12H,1,10-11H2,2-7H3;3*1,3-4H2,2H3;/b9-8+;;;;/t12-;;;;/m0..../s1 |
| InChIKey | BNALHNUBDFLMCM-KTEKPGDISA-N |
| XLogP | 9.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|