C19H24CrO6 — CID 135049178
carbon monoxide;[(E)-1-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybut-2-enylidene]chromium (PubChem CID 135049178) has the molecular formula C19H24CrO6 and a molecular weight of 400.39 g/mol. Its IUPAC name is carbon monoxide;[(E)-1-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybut-2-enylidene]chromium.
| Compound Name | carbon monoxide;[(E)-1-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybut-2-enylidene]chromium |
|---|---|
| PubChem CID | 135049178 |
| Molecular Formula | C19H24CrO6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | carbon monoxide;[(E)-1-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybut-2-enylidene]chromium |
| SMILES | C/C=C/C(=[Cr])O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C14H24O.5CO.Cr/c1-5-6-9-15-14-10-12(4)7-8-13(14)11(2)3;5*1-2;/h5-6,11-14H,7-8,10H2,1-4H3;;;;;;/b6-5+;;;;;;/t12-,13+,14-;;;;;;/m0....../s1 |
| InChIKey | JSMPZHWCVKEFKX-SMPOSTKXSA-N |
| XLogP | 3.53 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|