C30H20F8O6Pb — CID 135049361
(4-ethoxy-2,3,5,6-tetrafluorophenyl) [(4-ethoxy-2,3,5,6-tetrafluorophenoxy)carbonyl-diphenylplumbyl]formate (PubChem CID 135049361) has the molecular formula C30H20F8O6Pb and a molecular weight of 835.67 g/mol. Its IUPAC name is (4-ethoxy-2,3,5,6-tetrafluorophenyl) [(4-ethoxy-2,3,5,6-tetrafluorophenoxy)carbonyl-diphenylplumbyl]formate.
| Compound Name | (4-ethoxy-2,3,5,6-tetrafluorophenyl) [(4-ethoxy-2,3,5,6-tetrafluorophenoxy)carbonyl-diphenylplumbyl]formate |
|---|---|
| PubChem CID | 135049361 |
| Molecular Formula | C30H20F8O6Pb |
| Molecular Weight | 835.67 g/mol |
| Exact Mass | 836.09 |
| IUPAC Name | (4-ethoxy-2,3,5,6-tetrafluorophenyl) [(4-ethoxy-2,3,5,6-tetrafluorophenoxy)carbonyl-diphenylplumbyl]formate |
| SMILES | CCOc1c(F)c(F)c(OC(=O)[Pb](C(=O)Oc2c(F)c(F)c(OCC)c(F)c2F)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/2C9H5F4O3.2C6H5.Pb/c2*1-2-15-8-4(10)6(12)9(16-3-14)7(13)5(8)11;2*1-2-4-6-5-3-1;/h2*2H2,1H3;2*1-5H; |
| InChIKey | LJXVYAGFHKXDTA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|