About ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate
ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate (PubChem CID 135049386) has the molecular formula C17H32O2Si
and a molecular weight of 296.53 g/mol. Its IUPAC name is ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate |
| PubChem CID | 135049386 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate |
| SMILES | CCOC(=O)CC1CC(C)(C)C[C@H]1/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-7-19-16(18)11-15-13-17(2,3)12-14(15)9-8-10-20(4,5)6/h8-9,14-15H,7,10-13H2,1-6H3/b9-8+/t14-,15?/m1/s1 |
| InChIKey | QHXKXTWRMPYRJM-KMDZXENTSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate?
The IUPAC name of ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate (CID 135049386) is ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate.
What is the SMILES notation for ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate?
The canonical SMILES for ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate is CCOC(=O)CC1CC(C)(C)C[C@H]1/C=C/C[Si](C)(C)C.
What is the InChIKey of ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate?
The InChIKey is QHXKXTWRMPYRJM-KMDZXENTSA-N. The full InChI is InChI=1S/C17H32O2Si/c1-7-19-16(18)11-15-13-17(2,3)12-14(15)9-8-10-20(4,5)6/h8-9,14-15H,7,10-13H2,1-6H3/b9-8+/t14-,15?/m1/s1.
What are the key properties of ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate?
ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate has a molecular weight of 296.53 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2R)-4,4-dimethyl-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate is sourced from PubChem (CID 135049386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).