About [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane
[(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane (PubChem CID 135049584) has the molecular formula C20H40OSi
and a molecular weight of 324.63 g/mol. Its IUPAC name is [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane |
| PubChem CID | 135049584 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane |
| SMILES | CCCCCCCCCC/C=C/CC/C=C(\OC)[Si](C)(C)C |
| InChI | InChI=1S/C20H40OSi/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-2)22(3,4)5/h15-16,19H,6-14,17-18H2,1-5H3/b16-15+,20-19+ |
| InChIKey | RAVHPVNHNZFZSO-LMOVRVBNSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane?
The IUPAC name of [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane (CID 135049584) is [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane.
What is the SMILES notation for [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane?
The canonical SMILES for [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane is CCCCCCCCCC/C=C/CC/C=C(\OC)[Si](C)(C)C.
What is the InChIKey of [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane?
The InChIKey is RAVHPVNHNZFZSO-LMOVRVBNSA-N. The full InChI is InChI=1S/C20H40OSi/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-2)22(3,4)5/h15-16,19H,6-14,17-18H2,1-5H3/b16-15+,20-19+.
What are the key properties of [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane?
[(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane has a molecular weight of 324.63 g/mol, XLogP of 7.26, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,5E)-1-methoxyhexadeca-1,5-dienyl]-trimethylsilane is sourced from PubChem (CID 135049584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).