C18H16ClO9PW — CID 135049634
carbon monoxide;dimethyl (1S,4R)-7-(chloromethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;tungsten (PubChem CID 135049634) has the molecular formula C18H16ClO9PW and a molecular weight of 626.58 g/mol. Its IUPAC name is carbon monoxide;dimethyl (1S,4R)-7-(chloromethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;tungsten.
| Compound Name | carbon monoxide;dimethyl (1S,4R)-7-(chloromethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;tungsten |
|---|---|
| PubChem CID | 135049634 |
| Molecular Formula | C18H16ClO9PW |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 625.97 |
| IUPAC Name | carbon monoxide;dimethyl (1S,4R)-7-(chloromethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;tungsten |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C(C)=C(C)[C@H]1P2CCl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C13H16ClO4P.5CO.W/c1-6-7(2)11-9(13(16)18-4)8(12(15)17-3)10(6)19(11)5-14;5*1-2;/h10-11H,5H2,1-4H3;;;;;;/t10-,11+,19?;;;;;; |
| InChIKey | FXEWSIIMYFIVRV-ULTAHEMQSA-N |
| XLogP | 2.22 |
| TPSA | 152.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|