About ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate
ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate (PubChem CID 135049936) has the molecular formula C19H20NO2S2+
and a molecular weight of 358.51 g/mol. Its IUPAC name is ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate |
| PubChem CID | 135049936 |
| Molecular Formula | C19H20NO2S2+ |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate |
| SMILES | CCOC(=O)CN(c1ccccc1)C1CC(c2ccccc2)=[S+]S1 |
| InChI | InChI=1S/C19H20NO2S2/c1-2-22-19(21)14-20(16-11-7-4-8-12-16)18-13-17(23-24-18)15-9-5-3-6-10-15/h3-12,18H,2,13-14H2,1H3/q+1 |
| InChIKey | FWFLUCOKUALKMT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate?
The IUPAC name of ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate (CID 135049936) is ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate.
What is the SMILES notation for ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate?
The canonical SMILES for ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate is CCOC(=O)CN(c1ccccc1)C1CC(c2ccccc2)=[S+]S1.
What is the InChIKey of ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate?
The InChIKey is FWFLUCOKUALKMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20NO2S2/c1-2-22-19(21)14-20(16-11-7-4-8-12-16)18-13-17(23-24-18)15-9-5-3-6-10-15/h3-12,18H,2,13-14H2,1H3/q+1.
What are the key properties of ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate?
ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate has a molecular weight of 358.51 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(N-(5-phenyl-3,4-dihydrodithiol-1-ium-3-yl)anilino)acetate is sourced from PubChem (CID 135049936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).