About 3,4-dibutyl-2,5-dimethylthiophene
3,4-dibutyl-2,5-dimethylthiophene (PubChem CID 135050024) has the molecular formula C14H24S
and a molecular weight of 224.41 g/mol. Its IUPAC name is 3,4-dibutyl-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3,4-dibutyl-2,5-dimethylthiophene |
| PubChem CID | 135050024 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3,4-dibutyl-2,5-dimethylthiophene |
| SMILES | CCCCc1c(C)sc(C)c1CCCC |
| InChI | InChI=1S/C14H24S/c1-5-7-9-13-11(3)15-12(4)14(13)10-8-6-2/h5-10H2,1-4H3 |
| InChIKey | JUEHKKCLDSDJIY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dibutyl-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutyl-2,5-dimethylthiophene?
The IUPAC name of 3,4-dibutyl-2,5-dimethylthiophene (CID 135050024) is 3,4-dibutyl-2,5-dimethylthiophene.
What is the SMILES notation for 3,4-dibutyl-2,5-dimethylthiophene?
The canonical SMILES for 3,4-dibutyl-2,5-dimethylthiophene is CCCCc1c(C)sc(C)c1CCCC.
What is the InChIKey of 3,4-dibutyl-2,5-dimethylthiophene?
The InChIKey is JUEHKKCLDSDJIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24S/c1-5-7-9-13-11(3)15-12(4)14(13)10-8-6-2/h5-10H2,1-4H3.
What are the key properties of 3,4-dibutyl-2,5-dimethylthiophene?
3,4-dibutyl-2,5-dimethylthiophene has a molecular weight of 224.41 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutyl-2,5-dimethylthiophene is sourced from PubChem (CID 135050024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).