About dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate
dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate (PubChem CID 135050099) has the molecular formula C11H12BF4NOS
and a molecular weight of 293.09 g/mol. Its IUPAC name is dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate.
Molecular Properties
| Compound Name | dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate |
| PubChem CID | 135050099 |
| Molecular Formula | C11H12BF4NOS |
| Molecular Weight | 293.09 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate |
| SMILES | C[N+](C)=c1oc(-c2ccccc2)cs1.F[B-](F)(F)F |
| InChI | InChI=1S/C11H12NOS.BF4/c1-12(2)11-13-10(8-14-11)9-6-4-3-5-7-9;2-1(3,4)5/h3-8H,1-2H3;/q+1;-1 |
| InChIKey | AAKJXSIZCLHIDS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 16.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.09 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate?
The IUPAC name of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate (CID 135050099) is dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate.
What is the SMILES notation for dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate?
The canonical SMILES for dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate is C[N+](C)=c1oc(-c2ccccc2)cs1.F[B-](F)(F)F.
What is the InChIKey of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate?
The InChIKey is AAKJXSIZCLHIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NOS.BF4/c1-12(2)11-13-10(8-14-11)9-6-4-3-5-7-9;2-1(3,4)5/h3-8H,1-2H3;/q+1;-1.
What are the key properties of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate?
dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate has a molecular weight of 293.09 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium tetrafluoroborate is sourced from PubChem (CID 135050099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).