About lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane
lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 135050160) has the molecular formula C8H13LiO2
and a molecular weight of 148.13 g/mol. Its IUPAC name is lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 135050160 |
| Molecular Formula | C8H13LiO2 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | [CH2-]C1CCCC12OCCO2.[Li+] |
| InChI | InChI=1S/C8H13O2.Li/c1-7-3-2-4-8(7)9-5-6-10-8;/h7H,1-6H2;/q-1;+1 |
| InChIKey | LEOJFEPEMMNEAY-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane (CID 135050160) is lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane is [CH2-]C1CCCC12OCCO2.[Li+].
What is the InChIKey of lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane?
The InChIKey is LEOJFEPEMMNEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O2.Li/c1-7-3-2-4-8(7)9-5-6-10-8;/h7H,1-6H2;/q-1;+1.
What are the key properties of lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane?
lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane has a molecular weight of 148.13 g/mol, XLogP of -1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 9-methanidyl-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 135050160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).