C15H18Cl2FN — CID 135050209
3,3-dichloro-1-cyclohexyl-2-(4-fluorophenyl)azetidine (PubChem CID 135050209) has the molecular formula C15H18Cl2FN and a molecular weight of 302.22 g/mol. Its IUPAC name is 3,3-dichloro-1-cyclohexyl-2-(4-fluorophenyl)azetidine.
| Compound Name | 3,3-dichloro-1-cyclohexyl-2-(4-fluorophenyl)azetidine |
|---|---|
| PubChem CID | 135050209 |
| Molecular Formula | C15H18Cl2FN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3,3-dichloro-1-cyclohexyl-2-(4-fluorophenyl)azetidine |
| SMILES | Fc1ccc(C2N(C3CCCCC3)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H18Cl2FN/c16-15(17)10-19(13-4-2-1-3-5-13)14(15)11-6-8-12(18)9-7-11/h6-9,13-14H,1-5,10H2 |
| InChIKey | MCMFETILYCRFMO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|