C13H21LiO — CID 135050254
lithium (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-olate (PubChem CID 135050254) has the molecular formula C13H21LiO and a molecular weight of 200.25 g/mol. Its IUPAC name is lithium (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-olate.
| Compound Name | lithium (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-olate |
|---|---|
| PubChem CID | 135050254 |
| Molecular Formula | C13H21LiO |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | lithium (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-olate |
| SMILES | CC1(C)CCC[C@]2(C)C([O-])=CCC[C@@H]12.[Li+] |
| InChI | InChI=1S/C13H22O.Li/c1-12(2)8-5-9-13(3)10(12)6-4-7-11(13)14;/h7,10,14H,4-6,8-9H2,1-3H3;/q;+1/p-1/t10-,13-;/m0./s1 |
| InChIKey | ACQGRZPQIMNPDT-VVBGOIRUSA-M |
| XLogP | -0.14 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |