About [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol
[(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol (PubChem CID 135050262) has the molecular formula C9H20O2Si
and a molecular weight of 188.34 g/mol. Its IUPAC name is [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol |
| PubChem CID | 135050262 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol |
| SMILES | CC(C)[C@@H]1O[C@@]1(CO)[Si](C)(C)C |
| InChI | InChI=1S/C9H20O2Si/c1-7(2)8-9(6-10,11-8)12(3,4)5/h7-8,10H,6H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | VTSRWQLIUQUQNG-IUCAKERBSA-N |
| XLogP | 1.65 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol?
The IUPAC name of [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol (CID 135050262) is [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol.
What is the SMILES notation for [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol?
The canonical SMILES for [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol is CC(C)[C@@H]1O[C@@]1(CO)[Si](C)(C)C.
What is the InChIKey of [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol?
The InChIKey is VTSRWQLIUQUQNG-IUCAKERBSA-N. The full InChI is InChI=1S/C9H20O2Si/c1-7(2)8-9(6-10,11-8)12(3,4)5/h7-8,10H,6H2,1-5H3/t8-,9-/m0/s1.
What are the key properties of [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol?
[(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol has a molecular weight of 188.34 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-propan-2-yl-2-trimethylsilyloxiran-2-yl]methanol is sourced from PubChem (CID 135050262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).