C13H24O4S2 — CID 135050325
ethyl 2-[1-(2-ethoxy-2-oxoethyl)sulfanyl-2,2-dimethylpropyl]sulfanylacetate (PubChem CID 135050325) has the molecular formula C13H24O4S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is ethyl 2-[1-(2-ethoxy-2-oxoethyl)sulfanyl-2,2-dimethylpropyl]sulfanylacetate.
| Compound Name | ethyl 2-[1-(2-ethoxy-2-oxoethyl)sulfanyl-2,2-dimethylpropyl]sulfanylacetate |
|---|---|
| PubChem CID | 135050325 |
| Molecular Formula | C13H24O4S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethyl 2-[1-(2-ethoxy-2-oxoethyl)sulfanyl-2,2-dimethylpropyl]sulfanylacetate |
| SMILES | CCOC(=O)CSC(SCC(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C13H24O4S2/c1-6-16-10(14)8-18-12(13(3,4)5)19-9-11(15)17-7-2/h12H,6-9H2,1-5H3 |
| InChIKey | QVTGFMHZKYBIJP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|