C24H35LiO3 — CID 135050353
lithium (10R,13S)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-olate (PubChem CID 135050353) has the molecular formula C24H35LiO3 and a molecular weight of 378.48 g/mol. Its IUPAC name is lithium (10R,13S)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-olate.
| Compound Name | lithium (10R,13S)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-olate |
|---|---|
| PubChem CID | 135050353 |
| Molecular Formula | C24H35LiO3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | lithium (10R,13S)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-olate |
| SMILES | C[C@]12CCC(OC3CCCCO3)CC1=CCC1C2CC[C@]2(C)C([O-])=CCC12.[Li+] |
| InChI | InChI=1S/C24H36O3.Li/c1-23-12-10-17(27-22-5-3-4-14-26-22)15-16(23)6-7-18-19-8-9-21(25)24(19,2)13-11-20(18)23;/h6,9,17-20,22,25H,3-5,7-8,10-15H2,1-2H3;/q;+1/p-1/t17?,18?,19?,20?,22?,23-,24-;/m0./s1 |
| InChIKey | BWGPOCDBJWYNHJ-IUZXRGPMSA-M |
| XLogP | 1.72 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|