C20H32O5 — CID 135050471
(2S,3S)-2-(4-methoxyphenoxy)-3-methyl-5-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pentan-1-ol (PubChem CID 135050471) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2S,3S)-2-(4-methoxyphenoxy)-3-methyl-5-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pentan-1-ol.
| Compound Name | (2S,3S)-2-(4-methoxyphenoxy)-3-methyl-5-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pentan-1-ol |
|---|---|
| PubChem CID | 135050471 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2S,3S)-2-(4-methoxyphenoxy)-3-methyl-5-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pentan-1-ol |
| SMILES | COc1ccc(O[C@H](CO)[C@@H](C)CC[C@@H]2OC(C)(C)OC2(C)C)cc1 |
| InChI | InChI=1S/C20H32O5/c1-14(7-12-18-19(2,3)25-20(4,5)24-18)17(13-21)23-16-10-8-15(22-6)9-11-16/h8-11,14,17-18,21H,7,12-13H2,1-6H3/t14-,17+,18-/m0/s1 |
| InChIKey | PBCXSWFXADZONM-QGTPRVQTSA-N |
| XLogP | 3.78 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |