C13H21LiO2 — CID 135050662
lithium 4-ethyl-1,10,10-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (PubChem CID 135050662) has the molecular formula C13H21LiO2 and a molecular weight of 216.25 g/mol. Its IUPAC name is lithium 4-ethyl-1,10,10-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
| Compound Name | lithium 4-ethyl-1,10,10-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 135050662 |
| Molecular Formula | C13H21LiO2 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | lithium 4-ethyl-1,10,10-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
| SMILES | [CH2-]CC1OC2C3CCC(C)(C2O1)C3(C)C.[Li+] |
| InChI | InChI=1S/C13H21O2.Li/c1-5-9-14-10-8-6-7-13(4,11(10)15-9)12(8,2)3;/h8-11H,1,5-7H2,2-4H3;/q-1;+1 |
| InChIKey | FGVXDMHZKOQCFE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|