About [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate
[5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate (PubChem CID 135050669) has the molecular formula C28H39O5PSi
and a molecular weight of 514.68 g/mol. Its IUPAC name is [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate.
Molecular Properties
| Compound Name | [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate |
| PubChem CID | 135050669 |
| Molecular Formula | C28H39O5PSi |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC1=CC(OP(=O)(Oc2ccccc2)Oc2ccccc2)=CCC1 |
| InChI | InChI=1S/C28H39O5PSi/c1-28(2,3)35(4,5)30-22-13-12-15-24-16-14-21-27(23-24)33-34(29,31-25-17-8-6-9-18-25)32-26-19-10-7-11-20-26/h6-11,17-21,23H,12-16,22H2,1-5H3 |
| InChIKey | PZMZNSGXLWTCAY-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate?
The IUPAC name of [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate (CID 135050669) is [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate.
What is the SMILES notation for [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate?
The canonical SMILES for [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate is CC(C)(C)[Si](C)(C)OCCCCC1=CC(OP(=O)(Oc2ccccc2)Oc2ccccc2)=CCC1.
What is the InChIKey of [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate?
The InChIKey is PZMZNSGXLWTCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39O5PSi/c1-28(2,3)35(4,5)30-22-13-12-15-24-16-14-21-27(23-24)33-34(29,31-25-17-8-6-9-18-25)32-26-19-10-7-11-20-26/h6-11,17-21,23H,12-16,22H2,1-5H3.
What are the key properties of [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate?
[5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate has a molecular weight of 514.68 g/mol, XLogP of 9.07, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexa-1,5-dien-1-yl] diphenyl phosphate is sourced from PubChem (CID 135050669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).