C16H29LiO4 — CID 135050689
lithium (2R,4S,5S,6R)-4-[(2S,4R,5S)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-propan-2-yl]-1,3-dioxane (PubChem CID 135050689) has the molecular formula C16H29LiO4 and a molecular weight of 292.34 g/mol. Its IUPAC name is lithium (2R,4S,5S,6R)-4-[(2S,4R,5S)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-propan-2-yl]-1,3-dioxane.
| Compound Name | lithium (2R,4S,5S,6R)-4-[(2S,4R,5S)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-propan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 135050689 |
| Molecular Formula | C16H29LiO4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | lithium (2R,4S,5S,6R)-4-[(2S,4R,5S)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-propan-2-yl]-1,3-dioxane |
| SMILES | [CH2-][C@@H](C)[C@H]1O[C@@H](C)O[C@H]([C@]2(C)O[C@@H](C)O[C@H]2CC)[C@H]1C.[Li+] |
| InChI | InChI=1S/C16H29O4.Li/c1-8-13-16(7,20-12(6)17-13)15-10(4)14(9(2)3)18-11(5)19-15;/h9-15H,2,8H2,1,3-7H3;/q-1;+1/t9-,10-,11+,12-,13-,14+,15-,16+;/m0./s1 |
| InChIKey | FVKYODIOKIAHQA-VBQXTMSQSA-N |
| XLogP | 0.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|